C14H20N2O2 — CID 97401743
(3aR,6aS)-2-[(1R,2S)-2-methylcyclopropanecarbonyl]-5-prop-2-enyl-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one (PubChem CID 97401743) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is (3aR,6aS)-2-[(1R,2S)-2-methylcyclopropanecarbonyl]-5-prop-2-enyl-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one.
| Compound Name | (3aR,6aS)-2-[(1R,2S)-2-methylcyclopropanecarbonyl]-5-prop-2-enyl-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one |
|---|---|
| PubChem CID | 97401743 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | (3aR,6aS)-2-[(1R,2S)-2-methylcyclopropanecarbonyl]-5-prop-2-enyl-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one |
| SMILES | C=CCN1C[C@@H]2CN(C(=O)[C@@H]3C[C@@H]3C)C[C@@H]2C1=O |
| InChI | InChI=1S/C14H20N2O2/c1-3-4-15-6-10-7-16(8-12(10)14(15)18)13(17)11-5-9(11)2/h3,9-12H,1,4-8H2,2H3/t9-,10+,11+,12-/m0/s1 |
| InChIKey | UBVZDNMBGQUGHN-QCNOEVLYSA-N |
| XLogP | 0.75 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|