C14H16F3N3O2S — CID 97401823
(3aR,6aS)-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(3,3,3-trifluoropropanoyl)-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one (PubChem CID 97401823) has the molecular formula C14H16F3N3O2S and a molecular weight of 347.36 g/mol. Its IUPAC name is (3aR,6aS)-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(3,3,3-trifluoropropanoyl)-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one.
| Compound Name | (3aR,6aS)-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(3,3,3-trifluoropropanoyl)-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one |
|---|---|
| PubChem CID | 97401823 |
| Molecular Formula | C14H16F3N3O2S |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | (3aR,6aS)-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-(3,3,3-trifluoropropanoyl)-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one |
| SMILES | Cc1nc(CN2C[C@@H]3CN(C(=O)CC(F)(F)F)C[C@@H]3C2=O)cs1 |
| InChI | InChI=1S/C14H16F3N3O2S/c1-8-18-10(7-23-8)5-20-4-9-3-19(6-11(9)13(20)22)12(21)2-14(15,16)17/h7,9,11H,2-6H2,1H3/t9-,11-/m0/s1 |
| InChIKey | UGDFISWXDPTZMP-ONGXEEELSA-N |
| XLogP | 1.82 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |