C16H23N3O3 — CID 97402036
methyl 4-[(3aS,6aS)-2-(1H-pyrrol-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-4-oxobutanoate (PubChem CID 97402036) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is methyl 4-[(3aS,6aS)-2-(1H-pyrrol-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-4-oxobutanoate.
| Compound Name | methyl 4-[(3aS,6aS)-2-(1H-pyrrol-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 97402036 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | methyl 4-[(3aS,6aS)-2-(1H-pyrrol-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N1C[C@@H]2CN(Cc3ccc[nH]3)C[C@H]2C1 |
| InChI | InChI=1S/C16H23N3O3/c1-22-16(21)5-4-15(20)19-9-12-7-18(8-13(12)10-19)11-14-3-2-6-17-14/h2-3,6,12-13,17H,4-5,7-11H2,1H3/t12-,13-/m0/s1 |
| InChIKey | KQCLUGXKMPZQQX-STQMWFEESA-N |
| XLogP | 0.86 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |