C16H24F3N3O — CID 97402544
4-[[(3aR,7aS)-2-(3,3,3-trifluoropropyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]methyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 97402544) has the molecular formula C16H24F3N3O and a molecular weight of 331.38 g/mol. Its IUPAC name is 4-[[(3aR,7aS)-2-(3,3,3-trifluoropropyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]methyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[[(3aR,7aS)-2-(3,3,3-trifluoropropyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]methyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 97402544 |
| Molecular Formula | C16H24F3N3O |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 4-[[(3aR,7aS)-2-(3,3,3-trifluoropropyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]methyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1CN1CC[C@@H]2CN(CCC(F)(F)F)C[C@@H]2C1 |
| InChI | InChI=1S/C16H24F3N3O/c1-11-15(12(2)23-20-11)10-21-5-3-13-7-22(9-14(13)8-21)6-4-16(17,18)19/h13-14H,3-10H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | BEVGCEVJIQLVLI-KGLIPLIRSA-N |
| XLogP | 3.00 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |