C16H24N4 — CID 97402618
(3aS,7aS)-5-(cyclopropylmethyl)-2-(5-methylpyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine (PubChem CID 97402618) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is (3aS,7aS)-5-(cyclopropylmethyl)-2-(5-methylpyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine.
| Compound Name | (3aS,7aS)-5-(cyclopropylmethyl)-2-(5-methylpyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 97402618 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | (3aS,7aS)-5-(cyclopropylmethyl)-2-(5-methylpyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine |
| SMILES | Cc1cnc(N2C[C@H]3CCN(CC4CC4)C[C@H]3C2)nc1 |
| InChI | InChI=1S/C16H24N4/c1-12-6-17-16(18-7-12)20-10-14-4-5-19(8-13-2-3-13)9-15(14)11-20/h6-7,13-15H,2-5,8-11H2,1H3/t14-,15+/m1/s1 |
| InChIKey | ICVSXODNLQVSJE-CABCVRRESA-N |
| XLogP | 1.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |