C14H22N4O — CID 97402783
(4aR,7aS)-4-(cyclopropylmethyl)-6-(1H-pyrazol-5-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 97402783) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is (4aR,7aS)-4-(cyclopropylmethyl)-6-(1H-pyrazol-5-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aR,7aS)-4-(cyclopropylmethyl)-6-(1H-pyrazol-5-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 97402783 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (4aR,7aS)-4-(cyclopropylmethyl)-6-(1H-pyrazol-5-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | c1cc(CN2C[C@@H]3OCCN(CC4CC4)[C@@H]3C2)[nH]n1 |
| InChI | InChI=1S/C14H22N4O/c1-2-11(1)7-18-5-6-19-14-10-17(9-13(14)18)8-12-3-4-15-16-12/h3-4,11,13-14H,1-2,5-10H2,(H,15,16)/t13-,14+/m1/s1 |
| InChIKey | ONOIOAHICORJKW-KGLIPLIRSA-N |
| XLogP | 0.70 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |