C15H22N4O — CID 97402785
(4aR,7aS)-4-(cyclopropylmethyl)-6-(6-methylpyridazin-3-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 97402785) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is (4aR,7aS)-4-(cyclopropylmethyl)-6-(6-methylpyridazin-3-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aR,7aS)-4-(cyclopropylmethyl)-6-(6-methylpyridazin-3-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 97402785 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | (4aR,7aS)-4-(cyclopropylmethyl)-6-(6-methylpyridazin-3-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | Cc1ccc(N2C[C@@H]3OCCN(CC4CC4)[C@@H]3C2)nn1 |
| InChI | InChI=1S/C15H22N4O/c1-11-2-5-15(17-16-11)19-9-13-14(10-19)20-7-6-18(13)8-12-3-4-12/h2,5,12-14H,3-4,6-10H2,1H3/t13-,14+/m1/s1 |
| InChIKey | OKGPASFDVCCYEC-KGLIPLIRSA-N |
| XLogP | 1.08 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |