C15H22N4O2 — CID 97402895
2-[(4aR,7aS)-6-pyridin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N,N-dimethylacetamide (PubChem CID 97402895) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-[(4aR,7aS)-6-pyridin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(4aR,7aS)-6-pyridin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 97402895 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-[(4aR,7aS)-6-pyridin-2-yl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCO[C@H]2CN(c3ccccn3)C[C@H]21 |
| InChI | InChI=1S/C15H22N4O2/c1-17(2)15(20)11-18-7-8-21-13-10-19(9-12(13)18)14-5-3-4-6-16-14/h3-6,12-13H,7-11H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | DIVUMLBETQOIEI-OLZOCXBDSA-N |
| XLogP | 0.06 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |