C19H26N4O — CID 97402935
(3aS,4R,7aR)-2-[(1-methylpyrazol-4-yl)methyl]-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 97402935) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is (3aS,4R,7aR)-2-[(1-methylpyrazol-4-yl)methyl]-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | (3aS,4R,7aR)-2-[(1-methylpyrazol-4-yl)methyl]-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 97402935 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (3aS,4R,7aR)-2-[(1-methylpyrazol-4-yl)methyl]-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | Cn1cc(CN2C[C@@H]3CCC[C@@H](OCc4cccnc4)[C@@H]3C2)cn1 |
| InChI | InChI=1S/C19H26N4O/c1-22-10-16(9-21-22)11-23-12-17-5-2-6-19(18(17)13-23)24-14-15-4-3-7-20-8-15/h3-4,7-10,17-19H,2,5-6,11-14H2,1H3/t17-,18+,19+/m0/s1 |
| InChIKey | YVMMARZUXDINIP-IPMKNSEASA-N |
| XLogP | 2.63 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |