C15H24N4 — CID 97402946
1-[(3aR,4R,7aS)-2-pyrimidin-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]-N,N-dimethylmethanamine (PubChem CID 97402946) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is 1-[(3aR,4R,7aS)-2-pyrimidin-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(3aR,4R,7aS)-2-pyrimidin-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 97402946 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 1-[(3aR,4R,7aS)-2-pyrimidin-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)C[C@@H]1CCC[C@@H]2CN(c3ncccn3)C[C@@H]21 |
| InChI | InChI=1S/C15H24N4/c1-18(2)9-12-5-3-6-13-10-19(11-14(12)13)15-16-7-4-8-17-15/h4,7-8,12-14H,3,5-6,9-11H2,1-2H3/t12-,13+,14+/m0/s1 |
| InChIKey | RZVKYDMUMPKKOQ-BFHYXJOUSA-N |
| XLogP | 1.89 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |