C18H28N4O2 — CID 97402964
4-[[(3aR,4R,7aS)-2-(6-methoxypyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]morpholine (PubChem CID 97402964) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 4-[[(3aR,4R,7aS)-2-(6-methoxypyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]morpholine.
| Compound Name | 4-[[(3aR,4R,7aS)-2-(6-methoxypyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]morpholine |
|---|---|
| PubChem CID | 97402964 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 4-[[(3aR,4R,7aS)-2-(6-methoxypyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]morpholine |
| SMILES | COc1cc(N2C[C@H]3CCC[C@@H](CN4CCOCC4)[C@H]3C2)ncn1 |
| InChI | InChI=1S/C18H28N4O2/c1-23-18-9-17(19-13-20-18)22-11-15-4-2-3-14(16(15)12-22)10-21-5-7-24-8-6-21/h9,13-16H,2-8,10-12H2,1H3/t14-,15+,16+/m0/s1 |
| InChIKey | YXISEBFDKKIXAE-ARFHVFGLSA-N |
| XLogP | 1.67 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |