C17H26N4 — CID 97402974
N-[[(3aR,4R,7aS)-2-pyrimidin-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]-N-methylcyclopropanamine (PubChem CID 97402974) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is N-[[(3aR,4R,7aS)-2-pyrimidin-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]-N-methylcyclopropanamine.
| Compound Name | N-[[(3aR,4R,7aS)-2-pyrimidin-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]-N-methylcyclopropanamine |
|---|---|
| PubChem CID | 97402974 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | N-[[(3aR,4R,7aS)-2-pyrimidin-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]-N-methylcyclopropanamine |
| SMILES | CN(C[C@@H]1CCC[C@@H]2CN(c3ncccn3)C[C@@H]21)C1CC1 |
| InChI | InChI=1S/C17H26N4/c1-20(15-6-7-15)10-13-4-2-5-14-11-21(12-16(13)14)17-18-8-3-9-19-17/h3,8-9,13-16H,2,4-7,10-12H2,1H3/t13-,14+,16+/m0/s1 |
| InChIKey | IVQKJKFCZBNIIP-SQWLQELKSA-N |
| XLogP | 2.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |