C17H28N4O — CID 97402984
N-[[(3aR,4R,7aS)-2-pyrimidin-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]-2-methoxy-N-methylethanamine (PubChem CID 97402984) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is N-[[(3aR,4R,7aS)-2-pyrimidin-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]-2-methoxy-N-methylethanamine.
| Compound Name | N-[[(3aR,4R,7aS)-2-pyrimidin-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]-2-methoxy-N-methylethanamine |
|---|---|
| PubChem CID | 97402984 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | N-[[(3aR,4R,7aS)-2-pyrimidin-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]-2-methoxy-N-methylethanamine |
| SMILES | COCCN(C)C[C@@H]1CCC[C@@H]2CN(c3ncccn3)C[C@@H]21 |
| InChI | InChI=1S/C17H28N4O/c1-20(9-10-22-2)11-14-5-3-6-15-12-21(13-16(14)15)17-18-7-4-8-19-17/h4,7-8,14-16H,3,5-6,9-13H2,1-2H3/t14-,15+,16+/m0/s1 |
| InChIKey | UTFWPUZYBMVBRM-ARFHVFGLSA-N |
| XLogP | 1.91 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |