C15H19N3O2 — CID 97403049
1-[(3aS,7aS)-4-oxo-5-prop-2-enyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-2-carbonyl]cyclopropane-1-carbonitrile (PubChem CID 97403049) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-[(3aS,7aS)-4-oxo-5-prop-2-enyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-2-carbonyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[(3aS,7aS)-4-oxo-5-prop-2-enyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-2-carbonyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 97403049 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-[(3aS,7aS)-4-oxo-5-prop-2-enyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-2-carbonyl]cyclopropane-1-carbonitrile |
| SMILES | C=CCN1CC[C@@H]2CN(C(=O)C3(C#N)CC3)C[C@H]2C1=O |
| InChI | InChI=1S/C15H19N3O2/c1-2-6-17-7-3-11-8-18(9-12(11)13(17)19)14(20)15(10-16)4-5-15/h2,11-12H,1,3-9H2/t11-,12-/m1/s1 |
| InChIKey | JURWNGSZLITDFM-VXGBXAGGSA-N |
| XLogP | 0.78 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|