C16H22N4O — CID 97403060
(3aR,7aR)-5-(cyclopropylmethyl)-2-(5-methylpyrimidin-2-yl)-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one (PubChem CID 97403060) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is (3aR,7aR)-5-(cyclopropylmethyl)-2-(5-methylpyrimidin-2-yl)-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one.
| Compound Name | (3aR,7aR)-5-(cyclopropylmethyl)-2-(5-methylpyrimidin-2-yl)-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 97403060 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (3aR,7aR)-5-(cyclopropylmethyl)-2-(5-methylpyrimidin-2-yl)-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
| SMILES | Cc1cnc(N2C[C@@H]3CCN(CC4CC4)C(=O)[C@H]3C2)nc1 |
| InChI | InChI=1S/C16H22N4O/c1-11-6-17-16(18-7-11)20-9-13-4-5-19(8-12-2-3-12)15(21)14(13)10-20/h6-7,12-14H,2-5,8-10H2,1H3/t13-,14-/m0/s1 |
| InChIKey | RGMQXRSNRSSFCB-KBPBESRZSA-N |
| XLogP | 1.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |