C15H24N4O2S — CID 97403236
[(4aS,9aS)-4-(2-methylpropyl)-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl]-(thiadiazol-4-yl)methanone (PubChem CID 97403236) has the molecular formula C15H24N4O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is [(4aS,9aS)-4-(2-methylpropyl)-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl]-(thiadiazol-4-yl)methanone.
| Compound Name | [(4aS,9aS)-4-(2-methylpropyl)-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl]-(thiadiazol-4-yl)methanone |
|---|---|
| PubChem CID | 97403236 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | [(4aS,9aS)-4-(2-methylpropyl)-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-7-yl]-(thiadiazol-4-yl)methanone |
| SMILES | CC(C)CN1CCO[C@H]2CCN(C(=O)c3csnn3)CC[C@@H]21 |
| InChI | InChI=1S/C15H24N4O2S/c1-11(2)9-19-7-8-21-14-4-6-18(5-3-13(14)19)15(20)12-10-22-17-16-12/h10-11,13-14H,3-9H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | ZVPMVFAQJZGERK-KBPBESRZSA-N |
| XLogP | 1.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |