C17H24N2O2 — CID 97403363
[(5aR,8aS)-7-propan-2-yl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-phenylmethanone (PubChem CID 97403363) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is [(5aR,8aS)-7-propan-2-yl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-phenylmethanone.
| Compound Name | [(5aR,8aS)-7-propan-2-yl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 97403363 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | [(5aR,8aS)-7-propan-2-yl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-phenylmethanone |
| SMILES | CC(C)N1C[C@@H]2CN(C(=O)c3ccccc3)CCO[C@@H]2C1 |
| InChI | InChI=1S/C17H24N2O2/c1-13(2)19-11-15-10-18(8-9-21-16(15)12-19)17(20)14-6-4-3-5-7-14/h3-7,13,15-16H,8-12H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | WCXYOZKCSVMQEF-JKSUJKDBSA-N |
| XLogP | 1.87 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |