C17H25N3O4 — CID 97403392
[(5aR,9aS)-4-(oxan-4-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1,2-oxazol-5-yl)methanone (PubChem CID 97403392) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is [(5aR,9aS)-4-(oxan-4-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1,2-oxazol-5-yl)methanone.
| Compound Name | [(5aR,9aS)-4-(oxan-4-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1,2-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 97403392 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | [(5aR,9aS)-4-(oxan-4-yl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1,2-oxazol-5-yl)methanone |
| SMILES | O=C(c1ccno1)N1CC[C@@H]2CN(C3CCOCC3)CCO[C@@H]2C1 |
| InChI | InChI=1S/C17H25N3O4/c21-17(15-1-5-18-24-15)20-6-2-13-11-19(7-10-23-16(13)12-20)14-3-8-22-9-4-14/h1,5,13-14,16H,2-4,6-12H2/t13-,16-/m1/s1 |
| InChIKey | SAIFPZFQJUUUCW-CZUORRHYSA-N |
| XLogP | 1.02 |
| TPSA | 68.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |