C17H26N4O3S — CID 97403880
(4S,4aS,7aS)-N-(2-methylpropyl)-6-(5-methylpyrimidin-2-yl)-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide (PubChem CID 97403880) has the molecular formula C17H26N4O3S and a molecular weight of 366.49 g/mol. Its IUPAC name is (4S,4aS,7aS)-N-(2-methylpropyl)-6-(5-methylpyrimidin-2-yl)-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide.
| Compound Name | (4S,4aS,7aS)-N-(2-methylpropyl)-6-(5-methylpyrimidin-2-yl)-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 97403880 |
| Molecular Formula | C17H26N4O3S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (4S,4aS,7aS)-N-(2-methylpropyl)-6-(5-methylpyrimidin-2-yl)-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide |
| SMILES | Cc1cnc(N2C[C@@H]3[C@@H](C(=O)NCC(C)C)CCS(=O)(=O)[C@@H]3C2)nc1 |
| InChI | InChI=1S/C17H26N4O3S/c1-11(2)6-18-16(22)13-4-5-25(23,24)15-10-21(9-14(13)15)17-19-7-12(3)8-20-17/h7-8,11,13-15H,4-6,9-10H2,1-3H3,(H,18,22)/t13-,14+,15+/m0/s1 |
| InChIKey | ONUVEDCYHMPWDI-RRFJBIMHSA-N |
| XLogP | 0.80 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |