C16H22N4O4S — CID 97403895
[(4R,4aS,7aS)-1,1-dioxo-6-pyrimidin-2-yl-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrol-4-yl]-morpholin-4-ylmethanone (PubChem CID 97403895) has the molecular formula C16H22N4O4S and a molecular weight of 366.44 g/mol. Its IUPAC name is [(4R,4aS,7aS)-1,1-dioxo-6-pyrimidin-2-yl-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrol-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [(4R,4aS,7aS)-1,1-dioxo-6-pyrimidin-2-yl-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrol-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 97403895 |
| Molecular Formula | C16H22N4O4S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | [(4R,4aS,7aS)-1,1-dioxo-6-pyrimidin-2-yl-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrol-4-yl]-morpholin-4-ylmethanone |
| SMILES | O=C([C@@H]1CCS(=O)(=O)[C@@H]2CN(c3ncccn3)C[C@@H]21)N1CCOCC1 |
| InChI | InChI=1S/C16H22N4O4S/c21-15(19-5-7-24-8-6-19)12-2-9-25(22,23)14-11-20(10-13(12)14)16-17-3-1-4-18-16/h1,3-4,12-14H,2,5-11H2/t12-,13-,14-/m1/s1 |
| InChIKey | PYFKPCOTVCUPAR-MGPQQGTHSA-N |
| XLogP | -0.43 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |