C17H25N5O3S — CID 97403942
(4aR,7aS)-N-(cyclopropylmethyl)-6-methylsulfonyl-1-pyrimidin-2-yl-2,3,4,5,7,7a-hexahydropyrrolo[3,4-b]pyridine-4a-carboxamide (PubChem CID 97403942) has the molecular formula C17H25N5O3S and a molecular weight of 379.49 g/mol. Its IUPAC name is (4aR,7aS)-N-(cyclopropylmethyl)-6-methylsulfonyl-1-pyrimidin-2-yl-2,3,4,5,7,7a-hexahydropyrrolo[3,4-b]pyridine-4a-carboxamide.
| Compound Name | (4aR,7aS)-N-(cyclopropylmethyl)-6-methylsulfonyl-1-pyrimidin-2-yl-2,3,4,5,7,7a-hexahydropyrrolo[3,4-b]pyridine-4a-carboxamide |
|---|---|
| PubChem CID | 97403942 |
| Molecular Formula | C17H25N5O3S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | (4aR,7aS)-N-(cyclopropylmethyl)-6-methylsulfonyl-1-pyrimidin-2-yl-2,3,4,5,7,7a-hexahydropyrrolo[3,4-b]pyridine-4a-carboxamide |
| SMILES | CS(=O)(=O)N1C[C@H]2N(c3ncccn3)CCC[C@@]2(C(=O)NCC2CC2)C1 |
| InChI | InChI=1S/C17H25N5O3S/c1-26(24,25)21-11-14-17(12-21,15(23)20-10-13-4-5-13)6-2-9-22(14)16-18-7-3-8-19-16/h3,7-8,13-14H,2,4-6,9-12H2,1H3,(H,20,23)/t14-,17-/m1/s1 |
| InChIKey | NOXWWDHYNLJVET-RHSMWYFYSA-N |
| XLogP | 0.23 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |