C18H29N5O2 — CID 97403979
(3aR,8aR)-5-acetyl-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxamide (PubChem CID 97403979) has the molecular formula C18H29N5O2 and a molecular weight of 347.46 g/mol. Its IUPAC name is (3aR,8aR)-5-acetyl-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxamide.
| Compound Name | (3aR,8aR)-5-acetyl-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxamide |
|---|---|
| PubChem CID | 97403979 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | (3aR,8aR)-5-acetyl-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxamide |
| SMILES | CC(=O)N1CCC[C@]2(C(=O)N(C)C)CN(Cc3cnn(C)c3)C[C@@H]2C1 |
| InChI | InChI=1S/C18H29N5O2/c1-14(24)23-7-5-6-18(17(25)20(2)3)13-22(11-16(18)12-23)10-15-8-19-21(4)9-15/h8-9,16H,5-7,10-13H2,1-4H3/t16-,18+/m1/s1 |
| InChIKey | PCCJWUAKUFHWAN-AEFFLSMTSA-N |
| XLogP | 0.57 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |