C23H37N5O2 — CID 97403982
(3aR,8aR)-5-(2-cyclopentylacetyl)-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxamide (PubChem CID 97403982) has the molecular formula C23H37N5O2 and a molecular weight of 415.58 g/mol. Its IUPAC name is (3aR,8aR)-5-(2-cyclopentylacetyl)-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxamide.
| Compound Name | (3aR,8aR)-5-(2-cyclopentylacetyl)-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxamide |
|---|---|
| PubChem CID | 97403982 |
| Molecular Formula | C23H37N5O2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | (3aR,8aR)-5-(2-cyclopentylacetyl)-N,N-dimethyl-2-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxamide |
| SMILES | CN(C)C(=O)[C@]12CCCN(C(=O)CC3CCCC3)C[C@H]1CN(Cc1cnn(C)c1)C2 |
| InChI | InChI=1S/C23H37N5O2/c1-25(2)22(30)23-9-6-10-28(21(29)11-18-7-4-5-8-18)16-20(23)15-27(17-23)14-19-12-24-26(3)13-19/h12-13,18,20H,4-11,14-17H2,1-3H3/t20-,23+/m1/s1 |
| InChIKey | IZJRIYJNCZPTGE-OFNKIYASSA-N |
| XLogP | 2.13 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |