C12H24N2O3S — CID 97404025
1-[(3S,3aR,7aR)-5-ethylsulfonyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]-N,N-dimethylmethanamine (PubChem CID 97404025) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is 1-[(3S,3aR,7aR)-5-ethylsulfonyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(3S,3aR,7aR)-5-ethylsulfonyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 97404025 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 1-[(3S,3aR,7aR)-5-ethylsulfonyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-3-yl]-N,N-dimethylmethanamine |
| SMILES | CCS(=O)(=O)N1CC[C@H]2CO[C@H](CN(C)C)[C@H]2C1 |
| InChI | InChI=1S/C12H24N2O3S/c1-4-18(15,16)14-6-5-10-9-17-12(8-13(2)3)11(10)7-14/h10-12H,4-9H2,1-3H3/t10-,11-,12+/m0/s1 |
| InChIKey | KKOWDBCPZBYTDC-SDDRHHMPSA-N |
| XLogP | 0.23 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |