C17H22N6O2 — CID 97405486
[(3S)-oxolan-3-yl]-[1-[(pyrimidin-2-ylamino)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methanone (PubChem CID 97405486) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is [(3S)-oxolan-3-yl]-[1-[(pyrimidin-2-ylamino)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methanone.
| Compound Name | [(3S)-oxolan-3-yl]-[1-[(pyrimidin-2-ylamino)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methanone |
|---|---|
| PubChem CID | 97405486 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | [(3S)-oxolan-3-yl]-[1-[(pyrimidin-2-ylamino)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methanone |
| SMILES | O=C([C@H]1CCOC1)N1CCCn2cnc(CNc3ncccn3)c2C1 |
| InChI | InChI=1S/C17H22N6O2/c24-16(13-3-8-25-11-13)22-6-2-7-23-12-21-14(15(23)10-22)9-20-17-18-4-1-5-19-17/h1,4-5,12-13H,2-3,6-11H2,(H,18,19,20)/t13-/m0/s1 |
| InChIKey | VNYUIZOSBBYOAA-ZDUSSCGKSA-N |
| XLogP | 1.05 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |