C13H17N7O — CID 97405487
1-[(pyrimidin-2-ylamino)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-8-carboxamide (PubChem CID 97405487) has the molecular formula C13H17N7O and a molecular weight of 287.33 g/mol. Its IUPAC name is 1-[(pyrimidin-2-ylamino)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-8-carboxamide.
| Compound Name | 1-[(pyrimidin-2-ylamino)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-8-carboxamide |
|---|---|
| PubChem CID | 97405487 |
| Molecular Formula | C13H17N7O |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 1-[(pyrimidin-2-ylamino)methyl]-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-8-carboxamide |
| SMILES | NC(=O)N1CCCn2cnc(CNc3ncccn3)c2C1 |
| InChI | InChI=1S/C13H17N7O/c14-12(21)19-5-2-6-20-9-18-10(11(20)8-19)7-17-13-15-3-1-4-16-13/h1,3-4,9H,2,5-8H2,(H2,14,21)(H,15,16,17) |
| InChIKey | FGBUWHZZLWFMOW-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |