C17H21N7O — CID 97405527
cyclopent-3-en-1-yl-[3-[(pyrimidin-2-ylamino)methyl]-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-5-yl]methanone (PubChem CID 97405527) has the molecular formula C17H21N7O and a molecular weight of 339.40 g/mol. Its IUPAC name is cyclopent-3-en-1-yl-[3-[(pyrimidin-2-ylamino)methyl]-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-5-yl]methanone.
| Compound Name | cyclopent-3-en-1-yl-[3-[(pyrimidin-2-ylamino)methyl]-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-5-yl]methanone |
|---|---|
| PubChem CID | 97405527 |
| Molecular Formula | C17H21N7O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | cyclopent-3-en-1-yl-[3-[(pyrimidin-2-ylamino)methyl]-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-5-yl]methanone |
| SMILES | O=C(C1CC=CC1)N1CCCn2nnc(CNc3ncccn3)c2C1 |
| InChI | InChI=1S/C17H21N7O/c25-16(13-5-1-2-6-13)23-9-4-10-24-15(12-23)14(21-22-24)11-20-17-18-7-3-8-19-17/h1-3,7-8,13H,4-6,9-12H2,(H,18,19,20) |
| InChIKey | BHIKEIPZORLTGD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|