C16H27N5O2 — CID 97405621
2-ethoxy-1-[3-(piperidin-1-ylmethyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]ethanone (PubChem CID 97405621) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is 2-ethoxy-1-[3-(piperidin-1-ylmethyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]ethanone.
| Compound Name | 2-ethoxy-1-[3-(piperidin-1-ylmethyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]ethanone |
|---|---|
| PubChem CID | 97405621 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 2-ethoxy-1-[3-(piperidin-1-ylmethyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]ethanone |
| SMILES | CCOCC(=O)N1CCCn2c(CN3CCCCC3)nnc2C1 |
| InChI | InChI=1S/C16H27N5O2/c1-2-23-13-16(22)20-9-6-10-21-14(17-18-15(21)12-20)11-19-7-4-3-5-8-19/h2-13H2,1H3 |
| InChIKey | PUYWKNPLQRMOGE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |