C17H30N4O2 — CID 97405872
N,N-dimethyl-2-[[8-(oxan-4-yl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]methoxy]ethanamine (PubChem CID 97405872) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is N,N-dimethyl-2-[[8-(oxan-4-yl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]methoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[[8-(oxan-4-yl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]methoxy]ethanamine |
|---|---|
| PubChem CID | 97405872 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | N,N-dimethyl-2-[[8-(oxan-4-yl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]methoxy]ethanamine |
| SMILES | CN(C)CCOCc1ncn2c1CN(C1CCOCC1)CCC2 |
| InChI | InChI=1S/C17H30N4O2/c1-19(2)8-11-23-13-16-17-12-20(15-4-9-22-10-5-15)6-3-7-21(17)14-18-16/h14-15H,3-13H2,1-2H3 |
| InChIKey | CITZPXZJXPKLGJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|