C19H24N4O2 — CID 97406794
(3aR,4R,6aS)-2'-methyl-5'-oxo-N-(2-phenylethyl)spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-2-carboxamide (PubChem CID 97406794) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is (3aR,4R,6aS)-2'-methyl-5'-oxo-N-(2-phenylethyl)spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-2-carboxamide.
| Compound Name | (3aR,4R,6aS)-2'-methyl-5'-oxo-N-(2-phenylethyl)spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-2-carboxamide |
|---|---|
| PubChem CID | 97406794 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (3aR,4R,6aS)-2'-methyl-5'-oxo-N-(2-phenylethyl)spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-2-carboxamide |
| SMILES | CC1=N[C@@]2(CC[C@@H]3CN(C(=O)NCCc4ccccc4)C[C@@H]32)C(=O)N1 |
| InChI | InChI=1S/C19H24N4O2/c1-13-21-17(24)19(22-13)9-7-15-11-23(12-16(15)19)18(25)20-10-8-14-5-3-2-4-6-14/h2-6,15-16H,7-12H2,1H3,(H,20,25)(H,21,22,24)/t15-,16+,19-/m1/s1 |
| InChIKey | DFDOOGXFYAJOFO-JTDSTZFVSA-N |
| XLogP | 1.57 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |