C16H23N5O — CID 97408097
(2R,3aR,6aR)-N-(cyclopropylmethyl)-1-methyl-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide (PubChem CID 97408097) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is (2R,3aR,6aR)-N-(cyclopropylmethyl)-1-methyl-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide.
| Compound Name | (2R,3aR,6aR)-N-(cyclopropylmethyl)-1-methyl-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 97408097 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | (2R,3aR,6aR)-N-(cyclopropylmethyl)-1-methyl-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-2-carboxamide |
| SMILES | CN1[C@@H](C(=O)NCC2CC2)C[C@@H]2CN(c3ncccn3)C[C@@H]21 |
| InChI | InChI=1S/C16H23N5O/c1-20-13(15(22)19-8-11-3-4-11)7-12-9-21(10-14(12)20)16-17-5-2-6-18-16/h2,5-6,11-14H,3-4,7-10H2,1H3,(H,19,22)/t12-,13-,14+/m1/s1 |
| InChIKey | XSRGIMFUYLWREZ-MCIONIFRSA-N |
| XLogP | 0.51 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |