C19H29N3O3 — CID 97408104
[(7R,8aS)-7-(2-pyrrolidin-1-ylethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(2-methylfuran-3-yl)methanone (PubChem CID 97408104) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is [(7R,8aS)-7-(2-pyrrolidin-1-ylethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(2-methylfuran-3-yl)methanone.
| Compound Name | [(7R,8aS)-7-(2-pyrrolidin-1-ylethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(2-methylfuran-3-yl)methanone |
|---|---|
| PubChem CID | 97408104 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | [(7R,8aS)-7-(2-pyrrolidin-1-ylethoxy)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(2-methylfuran-3-yl)methanone |
| SMILES | Cc1occc1C(=O)N1CCN2C[C@H](OCCN3CCCC3)C[C@H]2C1 |
| InChI | InChI=1S/C19H29N3O3/c1-15-18(4-10-24-15)19(23)22-8-7-21-14-17(12-16(21)13-22)25-11-9-20-5-2-3-6-20/h4,10,16-17H,2-3,5-9,11-14H2,1H3/t16-,17+/m0/s1 |
| InChIKey | ZHPZTRNYXZSFHV-DLBZAZTESA-N |
| XLogP | 1.60 |
| TPSA | 49.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |