C19H21N3O2 — CID 97409892
[(3aR,7aR)-5-pyridin-3-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(4-hydroxyphenyl)methanone (PubChem CID 97409892) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is [(3aR,7aR)-5-pyridin-3-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(4-hydroxyphenyl)methanone.
| Compound Name | [(3aR,7aR)-5-pyridin-3-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 97409892 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | [(3aR,7aR)-5-pyridin-3-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(4-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)cc1)N1C[C@@H]2CCN(c3cccnc3)C[C@@H]2C1 |
| InChI | InChI=1S/C19H21N3O2/c23-18-5-3-14(4-6-18)19(24)22-11-15-7-9-21(12-16(15)13-22)17-2-1-8-20-10-17/h1-6,8,10,15-16,23H,7,9,11-13H2/t15-,16+/m0/s1 |
| InChIKey | HLZYQTWVMZIHOK-JKSUJKDBSA-N |
| XLogP | 2.39 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |