C17H26N4 — CID 97409928
(3aR,4R,7aS)-2-pyrimidin-2-yl-4-(pyrrolidin-1-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 97409928) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is (3aR,4R,7aS)-2-pyrimidin-2-yl-4-(pyrrolidin-1-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | (3aR,4R,7aS)-2-pyrimidin-2-yl-4-(pyrrolidin-1-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 97409928 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | (3aR,4R,7aS)-2-pyrimidin-2-yl-4-(pyrrolidin-1-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | c1cnc(N2C[C@H]3CCC[C@@H](CN4CCCC4)[C@H]3C2)nc1 |
| InChI | InChI=1S/C17H26N4/c1-2-10-20(9-1)11-14-5-3-6-15-12-21(13-16(14)15)17-18-7-4-8-19-17/h4,7-8,14-16H,1-3,5-6,9-13H2/t14-,15+,16+/m0/s1 |
| InChIKey | MYCPZKRETXCWLJ-ARFHVFGLSA-N |
| XLogP | 2.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |