C15H24N2O4S — CID 97409986
(5aR,9aS)-8-[(5-methylfuran-2-yl)methyl]-4-methylsulfonyl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine (PubChem CID 97409986) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is (5aR,9aS)-8-[(5-methylfuran-2-yl)methyl]-4-methylsulfonyl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine.
| Compound Name | (5aR,9aS)-8-[(5-methylfuran-2-yl)methyl]-4-methylsulfonyl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine |
|---|---|
| PubChem CID | 97409986 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (5aR,9aS)-8-[(5-methylfuran-2-yl)methyl]-4-methylsulfonyl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine |
| SMILES | Cc1ccc(CN2CC[C@@H]3CN(S(C)(=O)=O)CCO[C@@H]3C2)o1 |
| InChI | InChI=1S/C15H24N2O4S/c1-12-3-4-14(21-12)10-16-6-5-13-9-17(22(2,18)19)7-8-20-15(13)11-16/h3-4,13,15H,5-11H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | HKGPOQORXAOSJE-UKRRQHHQSA-N |
| XLogP | 1.07 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |