C15H26N4O — CID 97411249
(3S,3aR,6aS)-N,N-diethyl-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-amine (PubChem CID 97411249) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is (3S,3aR,6aS)-N,N-diethyl-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-amine.
| Compound Name | (3S,3aR,6aS)-N,N-diethyl-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-amine |
|---|---|
| PubChem CID | 97411249 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | (3S,3aR,6aS)-N,N-diethyl-1-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-amine |
| SMILES | CCN(CC)[C@@H]1CN(Cc2cnn(C)c2)[C@@H]2COC[C@H]12 |
| InChI | InChI=1S/C15H26N4O/c1-4-18(5-2)14-9-19(15-11-20-10-13(14)15)8-12-6-16-17(3)7-12/h6-7,13-15H,4-5,8-11H2,1-3H3/t13-,14-,15-/m1/s1 |
| InChIKey | ZHNJOKFJAFELIW-RBSFLKMASA-N |
| XLogP | 0.96 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |