C13H22N4O3S — CID 97411291
(3aS,7S,7aR)-N,N-dimethyl-2-(1-methylimidazol-4-yl)sulfonyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-amine (PubChem CID 97411291) has the molecular formula C13H22N4O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is (3aS,7S,7aR)-N,N-dimethyl-2-(1-methylimidazol-4-yl)sulfonyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-amine.
| Compound Name | (3aS,7S,7aR)-N,N-dimethyl-2-(1-methylimidazol-4-yl)sulfonyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-amine |
|---|---|
| PubChem CID | 97411291 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (3aS,7S,7aR)-N,N-dimethyl-2-(1-methylimidazol-4-yl)sulfonyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-amine |
| SMILES | CN(C)[C@@H]1COC[C@@H]2CN(S(=O)(=O)c3cn(C)cn3)C[C@@H]21 |
| InChI | InChI=1S/C13H22N4O3S/c1-15(2)12-8-20-7-10-4-17(5-11(10)12)21(18,19)13-6-16(3)9-14-13/h6,9-12H,4-5,7-8H2,1-3H3/t10-,11-,12+/m0/s1 |
| InChIKey | XIVNRHFDIQRDGI-SDDRHHMPSA-N |
| XLogP | -0.38 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |