C20H29N3OS — CID 97412472
1-(2,5-dihydropyrrol-1-yl)-2-[3-(1,3-thiazol-2-ylmethyl)-3-azaspiro[5.5]undecan-9-yl]ethanone (PubChem CID 97412472) has the molecular formula C20H29N3OS and a molecular weight of 359.54 g/mol. Its IUPAC name is 1-(2,5-dihydropyrrol-1-yl)-2-[3-(1,3-thiazol-2-ylmethyl)-3-azaspiro[5.5]undecan-9-yl]ethanone.
| Compound Name | 1-(2,5-dihydropyrrol-1-yl)-2-[3-(1,3-thiazol-2-ylmethyl)-3-azaspiro[5.5]undecan-9-yl]ethanone |
|---|---|
| PubChem CID | 97412472 |
| Molecular Formula | C20H29N3OS |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 1-(2,5-dihydropyrrol-1-yl)-2-[3-(1,3-thiazol-2-ylmethyl)-3-azaspiro[5.5]undecan-9-yl]ethanone |
| SMILES | O=C(CC1CCC2(CC1)CCN(Cc1nccs1)CC2)N1CC=CC1 |
| InChI | InChI=1S/C20H29N3OS/c24-19(23-10-1-2-11-23)15-17-3-5-20(6-4-17)7-12-22(13-8-20)16-18-21-9-14-25-18/h1-2,9,14,17H,3-8,10-13,15-16H2 |
| InChIKey | SNOXIIHTEKFZDN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|