About [7-(furan-2-ylmethyl)-1,7-diazaspiro[3.5]nonan-1-yl]-thiophen-3-ylmethanone
[7-(furan-2-ylmethyl)-1,7-diazaspiro[3.5]nonan-1-yl]-thiophen-3-ylmethanone (PubChem CID 97412792) has the molecular formula C17H20N2O2S
and a molecular weight of 316.43 g/mol. Its IUPAC name is [7-(furan-2-ylmethyl)-1,7-diazaspiro[3.5]nonan-1-yl]-thiophen-3-ylmethanone.
Molecular Properties
| Compound Name | [7-(furan-2-ylmethyl)-1,7-diazaspiro[3.5]nonan-1-yl]-thiophen-3-ylmethanone |
| PubChem CID | 97412792 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | [7-(furan-2-ylmethyl)-1,7-diazaspiro[3.5]nonan-1-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1CCC12CCN(Cc1ccco1)CC2 |
| InChI | InChI=1S/C17H20N2O2S/c20-16(14-3-11-22-13-14)19-9-6-17(19)4-7-18(8-5-17)12-15-2-1-10-21-15/h1-3,10-11,13H,4-9,12H2 |
| InChIKey | UTXZASAEZGHEDN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [7-(furan-2-ylmethyl)-1,7-diazaspiro[3.5]nonan-1-yl]-thiophen-3-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(furan-2-ylmethyl)-1,7-diazaspiro[3.5]nonan-1-yl]-thiophen-3-ylmethanone?
The IUPAC name of [7-(furan-2-ylmethyl)-1,7-diazaspiro[3.5]nonan-1-yl]-thiophen-3-ylmethanone (CID 97412792) is [7-(furan-2-ylmethyl)-1,7-diazaspiro[3.5]nonan-1-yl]-thiophen-3-ylmethanone.
What is the SMILES notation for [7-(furan-2-ylmethyl)-1,7-diazaspiro[3.5]nonan-1-yl]-thiophen-3-ylmethanone?
The canonical SMILES for [7-(furan-2-ylmethyl)-1,7-diazaspiro[3.5]nonan-1-yl]-thiophen-3-ylmethanone is O=C(c1ccsc1)N1CCC12CCN(Cc1ccco1)CC2.
What is the InChIKey of [7-(furan-2-ylmethyl)-1,7-diazaspiro[3.5]nonan-1-yl]-thiophen-3-ylmethanone?
The InChIKey is UTXZASAEZGHEDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O2S/c20-16(14-3-11-22-13-14)19-9-6-17(19)4-7-18(8-5-17)12-15-2-1-10-21-15/h1-3,10-11,13H,4-9,12H2.
What are the key properties of [7-(furan-2-ylmethyl)-1,7-diazaspiro[3.5]nonan-1-yl]-thiophen-3-ylmethanone?
[7-(furan-2-ylmethyl)-1,7-diazaspiro[3.5]nonan-1-yl]-thiophen-3-ylmethanone has a molecular weight of 316.43 g/mol, XLogP of 3.22, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(furan-2-ylmethyl)-1,7-diazaspiro[3.5]nonan-1-yl]-thiophen-3-ylmethanone is sourced from PubChem (CID 97412792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).