C13H15N5OS — CID 97413254
(4aR,7aS)-4-pyrimidin-2-yl-6-(1,3-thiazol-2-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 97413254) has the molecular formula C13H15N5OS and a molecular weight of 289.36 g/mol. Its IUPAC name is (4aR,7aS)-4-pyrimidin-2-yl-6-(1,3-thiazol-2-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aR,7aS)-4-pyrimidin-2-yl-6-(1,3-thiazol-2-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 97413254 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | (4aR,7aS)-4-pyrimidin-2-yl-6-(1,3-thiazol-2-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | c1cnc(N2CCO[C@H]3CN(c4nccs4)C[C@H]32)nc1 |
| InChI | InChI=1S/C13H15N5OS/c1-2-14-12(15-3-1)18-5-6-19-11-9-17(8-10(11)18)13-16-4-7-20-13/h1-4,7,10-11H,5-6,8-9H2/t10-,11+/m1/s1 |
| InChIKey | IEDKKVAOLZPTFA-MNOVXSKESA-N |
| XLogP | 1.03 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |