C25H26BrN3O2 — CID 97413798
2-[(4-bromophenyl)methoxy]-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]benzamide (PubChem CID 97413798) has the molecular formula C25H26BrN3O2 and a molecular weight of 480.41 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methoxy]-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]benzamide.
| Compound Name | 2-[(4-bromophenyl)methoxy]-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 97413798 |
| Molecular Formula | C25H26BrN3O2 |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 2-[(4-bromophenyl)methoxy]-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]benzamide |
| SMILES | CCN(CC)c1ccc(/C=N\NC(=O)c2ccccc2OCc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C25H26BrN3O2/c1-3-29(4-2)22-15-11-19(12-16-22)17-27-28-25(30)23-7-5-6-8-24(23)31-18-20-9-13-21(26)14-10-20/h5-17H,3-4,18H2,1-2H3,(H,28,30)/b27-17- |
| InChIKey | SCOPRPYJCSBIBE-PKAZHMFMSA-N |
| XLogP | 5.64 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|