C17H19Cl2N3O2S — CID 97413890
3,4-dichloro-N-[3-[(2S)-1-(dimethylamino)-1-oxopropan-2-yl]-4,5-dimethyl-1,3-thiazol-2-ylidene]benzamide (PubChem CID 97413890) has the molecular formula C17H19Cl2N3O2S and a molecular weight of 400.33 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-[(2S)-1-(dimethylamino)-1-oxopropan-2-yl]-4,5-dimethyl-1,3-thiazol-2-ylidene]benzamide.
| Compound Name | 3,4-dichloro-N-[3-[(2S)-1-(dimethylamino)-1-oxopropan-2-yl]-4,5-dimethyl-1,3-thiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 97413890 |
| Molecular Formula | C17H19Cl2N3O2S |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 3,4-dichloro-N-[3-[(2S)-1-(dimethylamino)-1-oxopropan-2-yl]-4,5-dimethyl-1,3-thiazol-2-ylidene]benzamide |
| SMILES | Cc1s/c(=N\C(=O)c2ccc(Cl)c(Cl)c2)n([C@@H](C)C(=O)N(C)C)c1C |
| InChI | InChI=1S/C17H19Cl2N3O2S/c1-9-11(3)25-17(22(9)10(2)16(24)21(4)5)20-15(23)12-6-7-13(18)14(19)8-12/h6-8,10H,1-5H3/b20-17-/t10-/m0/s1 |
| InChIKey | SDFQITKQBPLKDY-IQBMZCKMSA-N |
| XLogP | 3.86 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|