C18H22N4O2S — CID 97414176
(1S)-N-[2-(4-cyclopropyl-5-oxo-3-thiophen-2-yl-1,2,4-triazol-1-yl)ethyl]cyclohex-3-ene-1-carboxamide (PubChem CID 97414176) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is (1S)-N-[2-(4-cyclopropyl-5-oxo-3-thiophen-2-yl-1,2,4-triazol-1-yl)ethyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S)-N-[2-(4-cyclopropyl-5-oxo-3-thiophen-2-yl-1,2,4-triazol-1-yl)ethyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 97414176 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (1S)-N-[2-(4-cyclopropyl-5-oxo-3-thiophen-2-yl-1,2,4-triazol-1-yl)ethyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NCCn1nc(-c2cccs2)n(C2CC2)c1=O)[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C18H22N4O2S/c23-17(13-5-2-1-3-6-13)19-10-11-21-18(24)22(14-8-9-14)16(20-21)15-7-4-12-25-15/h1-2,4,7,12-14H,3,5-6,8-11H2,(H,19,23)/t13-/m1/s1 |
| InChIKey | LVPVIBJUVYKASJ-CYBMUJFWSA-N |
| XLogP | 2.58 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|