C10H15N3O2S2 — CID 97414567
N-[[(3R)-3-methoxythiolan-3-yl]methyl]-4-methylthiadiazole-5-carboxamide (PubChem CID 97414567) has the molecular formula C10H15N3O2S2 and a molecular weight of 273.38 g/mol. Its IUPAC name is N-[[(3R)-3-methoxythiolan-3-yl]methyl]-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-[[(3R)-3-methoxythiolan-3-yl]methyl]-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 97414567 |
| Molecular Formula | C10H15N3O2S2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | N-[[(3R)-3-methoxythiolan-3-yl]methyl]-4-methylthiadiazole-5-carboxamide |
| SMILES | CO[C@@]1(CNC(=O)c2snnc2C)CCSC1 |
| InChI | InChI=1S/C10H15N3O2S2/c1-7-8(17-13-12-7)9(14)11-5-10(15-2)3-4-16-6-10/h3-6H2,1-2H3,(H,11,14)/t10-/m1/s1 |
| InChIKey | FRZYEKXCMNNXCK-SNVBAGLBSA-N |
| XLogP | 1.10 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |