C17H20FN3O2S — CID 97414688
3-(4-fluorophenyl)-N-[[(3S)-3-methoxythiolan-3-yl]methyl]-1-methylpyrazole-5-carboxamide (PubChem CID 97414688) has the molecular formula C17H20FN3O2S and a molecular weight of 349.43 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[[(3S)-3-methoxythiolan-3-yl]methyl]-1-methylpyrazole-5-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N-[[(3S)-3-methoxythiolan-3-yl]methyl]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 97414688 |
| Molecular Formula | C17H20FN3O2S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[[(3S)-3-methoxythiolan-3-yl]methyl]-1-methylpyrazole-5-carboxamide |
| SMILES | CO[C@]1(CNC(=O)c2cc(-c3ccc(F)cc3)nn2C)CCSC1 |
| InChI | InChI=1S/C17H20FN3O2S/c1-21-15(9-14(20-21)12-3-5-13(18)6-4-12)16(22)19-10-17(23-2)7-8-24-11-17/h3-6,9H,7-8,10-11H2,1-2H3,(H,19,22)/t17-/m0/s1 |
| InChIKey | MYWXMIPERFNQMC-KRWDZBQOSA-N |
| XLogP | 2.48 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |