About 2-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)ethanol
2-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)ethanol (PubChem CID 97415505) has the molecular formula C16H23NO
and a molecular weight of 245.37 g/mol. Its IUPAC name is 2-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)ethanol.
Molecular Properties
| Compound Name | 2-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)ethanol |
| PubChem CID | 97415505 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 2-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)ethanol |
| SMILES | Cc1ccc2c(c1)CCC21CCN(CCO)CC1 |
| InChI | InChI=1S/C16H23NO/c1-13-2-3-15-14(12-13)4-5-16(15)6-8-17(9-7-16)10-11-18/h2-3,12,18H,4-11H2,1H3 |
| InChIKey | WLSQHFZADRFWHV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)ethanol?
The IUPAC name of 2-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)ethanol (CID 97415505) is 2-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)ethanol.
What is the SMILES notation for 2-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)ethanol?
The canonical SMILES for 2-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)ethanol is Cc1ccc2c(c1)CCC21CCN(CCO)CC1.
What is the InChIKey of 2-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)ethanol?
The InChIKey is WLSQHFZADRFWHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO/c1-13-2-3-15-14(12-13)4-5-16(15)6-8-17(9-7-16)10-11-18/h2-3,12,18H,4-11H2,1H3.
What are the key properties of 2-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)ethanol?
2-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)ethanol has a molecular weight of 245.37 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)ethanol is sourced from PubChem (CID 97415505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).