C15H25N3OS — CID 97415695
N-[[(2R,3aR,6aR)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]methyl]-N-methylpropan-2-amine (PubChem CID 97415695) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is N-[[(2R,3aR,6aR)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]methyl]-N-methylpropan-2-amine.
| Compound Name | N-[[(2R,3aR,6aR)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]methyl]-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 97415695 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-[[(2R,3aR,6aR)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]methyl]-N-methylpropan-2-amine |
| SMILES | CC(C)N(C)C[C@H]1C[C@@H]2CN(Cc3nccs3)C[C@@H]2O1 |
| InChI | InChI=1S/C15H25N3OS/c1-11(2)17(3)8-13-6-12-7-18(9-14(12)19-13)10-15-16-4-5-20-15/h4-5,11-14H,6-10H2,1-3H3/t12-,13-,14+/m1/s1 |
| InChIKey | CQEPVOZBKYVDFX-MCIONIFRSA-N |
| XLogP | 2.07 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |