C16H22N4O3 — CID 97415804
[(3aR,6aS)-1-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-[(3R)-oxolan-3-yl]methanone (PubChem CID 97415804) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is [(3aR,6aS)-1-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-[(3R)-oxolan-3-yl]methanone.
| Compound Name | [(3aR,6aS)-1-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-[(3R)-oxolan-3-yl]methanone |
|---|---|
| PubChem CID | 97415804 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | [(3aR,6aS)-1-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-[(3R)-oxolan-3-yl]methanone |
| SMILES | COc1cc(N2CC[C@@H]3[C@@H]2CCN3C(=O)[C@@H]2CCOC2)ncn1 |
| InChI | InChI=1S/C16H22N4O3/c1-22-15-8-14(17-10-18-15)19-5-2-13-12(19)3-6-20(13)16(21)11-4-7-23-9-11/h8,10-13H,2-7,9H2,1H3/t11-,12+,13-/m1/s1 |
| InChIKey | AEENCFBOYWBPOW-FRRDWIJNSA-N |
| XLogP | 0.70 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |