C19H27N3O2 — CID 97415837
(3aR,5R,7aR)-1-(cyclopropylmethyl)-N-(2-pyridin-4-ylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide (PubChem CID 97415837) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is (3aR,5R,7aR)-1-(cyclopropylmethyl)-N-(2-pyridin-4-ylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide.
| Compound Name | (3aR,5R,7aR)-1-(cyclopropylmethyl)-N-(2-pyridin-4-ylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 97415837 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | (3aR,5R,7aR)-1-(cyclopropylmethyl)-N-(2-pyridin-4-ylethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide |
| SMILES | O=C(NCCc1ccncc1)[C@H]1CC[C@@H]2[C@@H](CCN2CC2CC2)O1 |
| InChI | InChI=1S/C19H27N3O2/c23-19(21-11-7-14-5-9-20-10-6-14)18-4-3-16-17(24-18)8-12-22(16)13-15-1-2-15/h5-6,9-10,15-18H,1-4,7-8,11-13H2,(H,21,23)/t16-,17-,18-/m1/s1 |
| InChIKey | UMICXFLVXAYPFS-KZNAEPCWSA-N |
| XLogP | 1.77 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |