C13H25N5O2S — CID 97416014
N-[(7-ethylsulfonyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl)methyl]-N-methylpropan-2-amine (PubChem CID 97416014) has the molecular formula C13H25N5O2S and a molecular weight of 315.44 g/mol. Its IUPAC name is N-[(7-ethylsulfonyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl)methyl]-N-methylpropan-2-amine.
| Compound Name | N-[(7-ethylsulfonyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl)methyl]-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 97416014 |
| Molecular Formula | C13H25N5O2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | N-[(7-ethylsulfonyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl)methyl]-N-methylpropan-2-amine |
| SMILES | CCS(=O)(=O)N1CCc2nnc(CN(C)C(C)C)n2CC1 |
| InChI | InChI=1S/C13H25N5O2S/c1-5-21(19,20)17-7-6-12-14-15-13(18(12)9-8-17)10-16(4)11(2)3/h11H,5-10H2,1-4H3 |
| InChIKey | VPDHWSJVHKPGIP-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |